C15H10INO3 — CID 91681322
methyl 2-(3-iodophenyl)-1,3-benzoxazole-5-carboxylate (PubChem CID 91681322) has the molecular formula C15H10INO3 and a molecular weight of 379.15 g/mol. Its IUPAC name is methyl 2-(3-iodophenyl)-1,3-benzoxazole-5-carboxylate.
| Compound Name | methyl 2-(3-iodophenyl)-1,3-benzoxazole-5-carboxylate |
|---|---|
| PubChem CID | 91681322 |
| Molecular Formula | C15H10INO3 |
| Molecular Weight | 379.15 g/mol |
| Exact Mass | 378.97 |
| IUPAC Name | methyl 2-(3-iodophenyl)-1,3-benzoxazole-5-carboxylate |
| SMILES | COC(=O)c1ccc2oc(-c3cccc(I)c3)nc2c1 |
| InChI | InChI=1S/C15H10INO3/c1-19-15(18)10-5-6-13-12(8-10)17-14(20-13)9-3-2-4-11(16)7-9/h2-8H,1H3 |
| InChIKey | AIVLOHIYSAYCDU-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.15 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|