C15H10BrNO3 — CID 91682443
methyl 2-(3-bromophenyl)-1,3-benzoxazole-5-carboxylate (PubChem CID 91682443) has the molecular formula C15H10BrNO3 and a molecular weight of 332.15 g/mol. Its IUPAC name is methyl 2-(3-bromophenyl)-1,3-benzoxazole-5-carboxylate.
| Compound Name | methyl 2-(3-bromophenyl)-1,3-benzoxazole-5-carboxylate |
|---|---|
| PubChem CID | 91682443 |
| Molecular Formula | C15H10BrNO3 |
| Molecular Weight | 332.15 g/mol |
| Exact Mass | 330.98 |
| IUPAC Name | methyl 2-(3-bromophenyl)-1,3-benzoxazole-5-carboxylate |
| SMILES | COC(=O)c1ccc2oc(-c3cccc(Br)c3)nc2c1 |
| InChI | InChI=1S/C15H10BrNO3/c1-19-15(18)10-5-6-13-12(8-10)17-14(20-13)9-3-2-4-11(16)7-9/h2-8H,1H3 |
| InChIKey | JJHARFCVCDUCGZ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.15 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |