methyl 2-(3-bromophenyl)-1,3-benzoxazole-5-carboxylate

C15H10BrNO3 — CID 91682443

IUPACmethyl 2-(3-bromophenyl)-1,3-benzoxazole-5-carboxylate
SMILESCOC(=O)c1ccc2oc(-c3cccc(Br)c3)nc2c1
InChIInChI=1S/C15H10BrNO3/c1-19-15(18)10-5-6-13-12(8-10)17-14(20-13)9-3-2-4-11(16)7-9/h2-8H,1H3
InChIKeyJJHARFCVCDUCGZ-UHFFFAOYSA-N
MW332.15 g/mol
LogP4.04
Rot. Bonds2

About methyl 2-(3-bromophenyl)-1,3-benzoxazole-5-carboxylate

methyl 2-(3-bromophenyl)-1,3-benzoxazole-5-carboxylate (PubChem CID 91682443) has the molecular formula C15H10BrNO3 and a molecular weight of 332.15 g/mol. Its IUPAC name is methyl 2-(3-bromophenyl)-1,3-benzoxazole-5-carboxylate.

Molecular Properties

Compound Namemethyl 2-(3-bromophenyl)-1,3-benzoxazole-5-carboxylate
PubChem CID91682443
Molecular FormulaC15H10BrNO3
Molecular Weight332.15 g/mol
Exact Mass330.98
IUPAC Namemethyl 2-(3-bromophenyl)-1,3-benzoxazole-5-carboxylate
SMILESCOC(=O)c1ccc2oc(-c3cccc(Br)c3)nc2c1
InChIInChI=1S/C15H10BrNO3/c1-19-15(18)10-5-6-13-12(8-10)17-14(20-13)9-3-2-4-11(16)7-9/h2-8H,1H3
InChIKeyJJHARFCVCDUCGZ-UHFFFAOYSA-N
XLogP4.04
TPSA52.33 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500332.15
LogP ≤ 54.04
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 2-(3-bromophenyl)-1,3-benzoxazole-5-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(3-bromophenyl)-1,3-benzoxazole-5-carboxylate?
The IUPAC name of methyl 2-(3-bromophenyl)-1,3-benzoxazole-5-carboxylate (CID 91682443) is methyl 2-(3-bromophenyl)-1,3-benzoxazole-5-carboxylate.
What is the SMILES notation for methyl 2-(3-bromophenyl)-1,3-benzoxazole-5-carboxylate?
The canonical SMILES for methyl 2-(3-bromophenyl)-1,3-benzoxazole-5-carboxylate is COC(=O)c1ccc2oc(-c3cccc(Br)c3)nc2c1.
What is the InChIKey of methyl 2-(3-bromophenyl)-1,3-benzoxazole-5-carboxylate?
The InChIKey is JJHARFCVCDUCGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10BrNO3/c1-19-15(18)10-5-6-13-12(8-10)17-14(20-13)9-3-2-4-11(16)7-9/h2-8H,1H3.
What are the key properties of methyl 2-(3-bromophenyl)-1,3-benzoxazole-5-carboxylate?
methyl 2-(3-bromophenyl)-1,3-benzoxazole-5-carboxylate has a molecular weight of 332.15 g/mol, XLogP of 4.04, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(3-bromophenyl)-1,3-benzoxazole-5-carboxylate is sourced from PubChem (CID 91682443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).