C20H16BrNO3 — CID 59132779
methyl 3-[2-(3-bromophenyl)-1,3-benzoxazol-5-yl]hex-4-ynoate (PubChem CID 59132779) has the molecular formula C20H16BrNO3 and a molecular weight of 398.26 g/mol. Its IUPAC name is methyl 3-[2-(3-bromophenyl)-1,3-benzoxazol-5-yl]hex-4-ynoate.
| Compound Name | methyl 3-[2-(3-bromophenyl)-1,3-benzoxazol-5-yl]hex-4-ynoate |
|---|---|
| PubChem CID | 59132779 |
| Molecular Formula | C20H16BrNO3 |
| Molecular Weight | 398.26 g/mol |
| Exact Mass | 397.03 |
| IUPAC Name | methyl 3-[2-(3-bromophenyl)-1,3-benzoxazol-5-yl]hex-4-ynoate |
| SMILES | CC#CC(CC(=O)OC)c1ccc2oc(-c3cccc(Br)c3)nc2c1 |
| InChI | InChI=1S/C20H16BrNO3/c1-3-5-13(12-19(23)24-2)14-8-9-18-17(11-14)22-20(25-18)15-6-4-7-16(21)10-15/h4,6-11,13H,12H2,1-2H3 |
| InChIKey | UWJXLNSTAHBCJA-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.26 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|