C26H18F3NO3 — CID 142779797
3-[2-[3-phenyl-2-(trifluoromethyl)phenyl]-1,3-benzoxazol-5-yl]hex-4-ynoic acid (PubChem CID 142779797) has the molecular formula C26H18F3NO3 and a molecular weight of 449.43 g/mol. Its IUPAC name is 3-[2-[3-phenyl-2-(trifluoromethyl)phenyl]-1,3-benzoxazol-5-yl]hex-4-ynoic acid.
| Compound Name | 3-[2-[3-phenyl-2-(trifluoromethyl)phenyl]-1,3-benzoxazol-5-yl]hex-4-ynoic acid |
|---|---|
| PubChem CID | 142779797 |
| Molecular Formula | C26H18F3NO3 |
| Molecular Weight | 449.43 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | 3-[2-[3-phenyl-2-(trifluoromethyl)phenyl]-1,3-benzoxazol-5-yl]hex-4-ynoic acid |
| SMILES | CC#CC(CC(=O)O)c1ccc2oc(-c3cccc(-c4ccccc4)c3C(F)(F)F)nc2c1 |
| InChI | InChI=1S/C26H18F3NO3/c1-2-7-17(15-23(31)32)18-12-13-22-21(14-18)30-25(33-22)20-11-6-10-19(24(20)26(27,28)29)16-8-4-3-5-9-16/h3-6,8-14,17H,15H2,1H3,(H,31,32) |
| InChIKey | JBPYUSODLXANFL-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.43 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|