C25H22O3 — CID 57391960
3-[4-[(4-phenylphenyl)methoxy]phenyl]hex-4-ynoic acid (PubChem CID 57391960) has the molecular formula C25H22O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is 3-[4-[(4-phenylphenyl)methoxy]phenyl]hex-4-ynoic acid.
| Compound Name | 3-[4-[(4-phenylphenyl)methoxy]phenyl]hex-4-ynoic acid |
|---|---|
| PubChem CID | 57391960 |
| Molecular Formula | C25H22O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 3-[4-[(4-phenylphenyl)methoxy]phenyl]hex-4-ynoic acid |
| SMILES | CC#CC(CC(=O)O)c1ccc(OCc2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C25H22O3/c1-2-6-23(17-25(26)27)22-13-15-24(16-14-22)28-18-19-9-11-21(12-10-19)20-7-4-3-5-8-20/h3-5,7-16,23H,17-18H2,1H3,(H,26,27) |
| InChIKey | SVSDEDUBFFMJKW-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|