C20H20O4 — CID 124504866
(3R)-3-[4-[(3-methoxyphenyl)methoxy]phenyl]hex-4-ynoic acid (PubChem CID 124504866) has the molecular formula C20H20O4 and a molecular weight of 324.38 g/mol. Its IUPAC name is (3R)-3-[4-[(3-methoxyphenyl)methoxy]phenyl]hex-4-ynoic acid.
| Compound Name | (3R)-3-[4-[(3-methoxyphenyl)methoxy]phenyl]hex-4-ynoic acid |
|---|---|
| PubChem CID | 124504866 |
| Molecular Formula | C20H20O4 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | (3R)-3-[4-[(3-methoxyphenyl)methoxy]phenyl]hex-4-ynoic acid |
| SMILES | CC#C[C@H](CC(=O)O)c1ccc(OCc2cccc(OC)c2)cc1 |
| InChI | InChI=1S/C20H20O4/c1-3-5-17(13-20(21)22)16-8-10-18(11-9-16)24-14-15-6-4-7-19(12-15)23-2/h4,6-12,17H,13-14H2,1-2H3,(H,21,22)/t17-/m1/s1 |
| InChIKey | IBHBAEYSGFZPIC-QGZVFWFLSA-N |
| XLogP | 3.86 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|