C19H17BrO3 — CID 68673801
(3S)-3-[4-[(4-bromophenyl)methoxy]phenyl]hex-4-ynoic acid (PubChem CID 68673801) has the molecular formula C19H17BrO3 and a molecular weight of 373.25 g/mol. Its IUPAC name is (3S)-3-[4-[(4-bromophenyl)methoxy]phenyl]hex-4-ynoic acid.
| Compound Name | (3S)-3-[4-[(4-bromophenyl)methoxy]phenyl]hex-4-ynoic acid |
|---|---|
| PubChem CID | 68673801 |
| Molecular Formula | C19H17BrO3 |
| Molecular Weight | 373.25 g/mol |
| Exact Mass | 372.04 |
| IUPAC Name | (3S)-3-[4-[(4-bromophenyl)methoxy]phenyl]hex-4-ynoic acid |
| SMILES | CC#C[C@@H](CC(=O)O)c1ccc(OCc2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C19H17BrO3/c1-2-3-16(12-19(21)22)15-6-10-18(11-7-15)23-13-14-4-8-17(20)9-5-14/h4-11,16H,12-13H2,1H3,(H,21,22)/t16-/m0/s1 |
| InChIKey | HNWLMLSMKMKCBL-INIZCTEOSA-N |
| XLogP | 4.61 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.25 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|