C29H29NO3 — CID 86279827
(3S)-3-[4-[[4-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)phenyl]methoxy]phenyl]hex-4-ynoic acid (PubChem CID 86279827) has the molecular formula C29H29NO3 and a molecular weight of 439.56 g/mol. Its IUPAC name is (3S)-3-[4-[[4-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)phenyl]methoxy]phenyl]hex-4-ynoic acid.
| Compound Name | (3S)-3-[4-[[4-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)phenyl]methoxy]phenyl]hex-4-ynoic acid |
|---|---|
| PubChem CID | 86279827 |
| Molecular Formula | C29H29NO3 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | (3S)-3-[4-[[4-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)phenyl]methoxy]phenyl]hex-4-ynoic acid |
| SMILES | CC#C[C@@H](CC(=O)O)c1ccc(OCc2ccc(CN3CCc4ccccc4C3)cc2)cc1 |
| InChI | InChI=1S/C29H29NO3/c1-2-5-26(18-29(31)32)25-12-14-28(15-13-25)33-21-23-10-8-22(9-11-23)19-30-17-16-24-6-3-4-7-27(24)20-30/h3-4,6-15,26H,16-21H2,1H3,(H,31,32)/t26-/m0/s1 |
| InChIKey | ZVVMZGOYSQGIEA-SANMLTNESA-N |
| XLogP | 5.41 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|