C28H27NO4S — CID 122511136
3-[4-[[3-[(2-formyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)methyl]phenyl]methoxy]phenyl]hex-4-ynoic acid (PubChem CID 122511136) has the molecular formula C28H27NO4S and a molecular weight of 473.59 g/mol. Its IUPAC name is 3-[4-[[3-[(2-formyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)methyl]phenyl]methoxy]phenyl]hex-4-ynoic acid.
| Compound Name | 3-[4-[[3-[(2-formyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)methyl]phenyl]methoxy]phenyl]hex-4-ynoic acid |
|---|---|
| PubChem CID | 122511136 |
| Molecular Formula | C28H27NO4S |
| Molecular Weight | 473.59 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | 3-[4-[[3-[(2-formyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)methyl]phenyl]methoxy]phenyl]hex-4-ynoic acid |
| SMILES | CC#CC(CC(=O)O)c1ccc(OCc2cccc(CN3CCc4sc(C=O)cc4C3)c2)cc1 |
| InChI | InChI=1S/C28H27NO4S/c1-2-4-23(15-28(31)32)22-7-9-25(10-8-22)33-19-21-6-3-5-20(13-21)16-29-12-11-27-24(17-29)14-26(18-30)34-27/h3,5-10,13-14,18,23H,11-12,15-17,19H2,1H3,(H,31,32) |
| InChIKey | QUAZUBZGIQAVFQ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.59 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|