C29H29NO5S — CID 122511148
3-[4-[[3-[(2-acetyloxy-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)methyl]phenyl]methoxy]phenyl]hex-4-ynoic acid (PubChem CID 122511148) has the molecular formula C29H29NO5S and a molecular weight of 503.62 g/mol. Its IUPAC name is 3-[4-[[3-[(2-acetyloxy-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)methyl]phenyl]methoxy]phenyl]hex-4-ynoic acid.
| Compound Name | 3-[4-[[3-[(2-acetyloxy-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)methyl]phenyl]methoxy]phenyl]hex-4-ynoic acid |
|---|---|
| PubChem CID | 122511148 |
| Molecular Formula | C29H29NO5S |
| Molecular Weight | 503.62 g/mol |
| Exact Mass | 503.18 |
| IUPAC Name | 3-[4-[[3-[(2-acetyloxy-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)methyl]phenyl]methoxy]phenyl]hex-4-ynoic acid |
| SMILES | CC#CC(CC(=O)O)c1ccc(OCc2cccc(CN3CCc4sc(OC(C)=O)cc4C3)c2)cc1 |
| InChI | InChI=1S/C29H29NO5S/c1-3-5-24(15-28(32)33)23-8-10-26(11-9-23)34-19-22-7-4-6-21(14-22)17-30-13-12-27-25(18-30)16-29(36-27)35-20(2)31/h4,6-11,14,16,24H,12-13,15,17-19H2,1-2H3,(H,32,33) |
| InChIKey | OXSQYOUIPYDIFK-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.62 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|