C19H18O3 — CID 59132754
(3R)-3-(4-phenylmethoxyphenyl)hex-4-ynoic acid (PubChem CID 59132754) has the molecular formula C19H18O3 and a molecular weight of 294.35 g/mol. Its IUPAC name is (3R)-3-(4-phenylmethoxyphenyl)hex-4-ynoic acid.
| Compound Name | (3R)-3-(4-phenylmethoxyphenyl)hex-4-ynoic acid |
|---|---|
| PubChem CID | 59132754 |
| Molecular Formula | C19H18O3 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | (3R)-3-(4-phenylmethoxyphenyl)hex-4-ynoic acid |
| SMILES | CC#C[C@H](CC(=O)O)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C19H18O3/c1-2-6-17(13-19(20)21)16-9-11-18(12-10-16)22-14-15-7-4-3-5-8-15/h3-5,7-12,17H,13-14H2,1H3,(H,20,21)/t17-/m1/s1 |
| InChIKey | BWNUPVDPQMJAFP-QGZVFWFLSA-N |
| XLogP | 3.85 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|