(3R)-3-[4-(2,2-dimethylpropoxy)phenyl]hex-4-ynoic acid

C17H22O3 — CID 155409330

IUPAC(3R)-3-[4-(2,2-dimethylpropoxy)phenyl]hex-4-ynoic acid
SMILESCC#C[C@H](CC(=O)O)c1ccc(OCC(C)(C)C)cc1
InChIInChI=1S/C17H22O3/c1-5-6-14(11-16(18)19)13-7-9-15(10-8-13)20-12-17(2,3)4/h7-10,14H,11-12H2,1-4H3,(H,18,19)/t14-/m1/s1
InChIKeyTWHUGSIPDJQFDN-CQSZACIVSA-N
MW274.36 g/mol
LogP3.69
Rot. Bonds5

About (3R)-3-[4-(2,2-dimethylpropoxy)phenyl]hex-4-ynoic acid

(3R)-3-[4-(2,2-dimethylpropoxy)phenyl]hex-4-ynoic acid (PubChem CID 155409330) has the molecular formula C17H22O3 and a molecular weight of 274.36 g/mol. Its IUPAC name is (3R)-3-[4-(2,2-dimethylpropoxy)phenyl]hex-4-ynoic acid.

Molecular Properties

Compound Name(3R)-3-[4-(2,2-dimethylpropoxy)phenyl]hex-4-ynoic acid
PubChem CID155409330
Molecular FormulaC17H22O3
Molecular Weight274.36 g/mol
Exact Mass274.16
IUPAC Name(3R)-3-[4-(2,2-dimethylpropoxy)phenyl]hex-4-ynoic acid
SMILESCC#C[C@H](CC(=O)O)c1ccc(OCC(C)(C)C)cc1
InChIInChI=1S/C17H22O3/c1-5-6-14(11-16(18)19)13-7-9-15(10-8-13)20-12-17(2,3)4/h7-10,14H,11-12H2,1-4H3,(H,18,19)/t14-/m1/s1
InChIKeyTWHUGSIPDJQFDN-CQSZACIVSA-N
XLogP3.69
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500274.36
LogP ≤ 53.69
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'triple_bond', 'substructure': 'N/A'}

Analyze (3R)-3-[4-(2,2-dimethylpropoxy)phenyl]hex-4-ynoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3R)-3-[4-(2,2-dimethylpropoxy)phenyl]hex-4-ynoic acid?
The IUPAC name of (3R)-3-[4-(2,2-dimethylpropoxy)phenyl]hex-4-ynoic acid (CID 155409330) is (3R)-3-[4-(2,2-dimethylpropoxy)phenyl]hex-4-ynoic acid.
What is the SMILES notation for (3R)-3-[4-(2,2-dimethylpropoxy)phenyl]hex-4-ynoic acid?
The canonical SMILES for (3R)-3-[4-(2,2-dimethylpropoxy)phenyl]hex-4-ynoic acid is CC#C[C@H](CC(=O)O)c1ccc(OCC(C)(C)C)cc1.
What is the InChIKey of (3R)-3-[4-(2,2-dimethylpropoxy)phenyl]hex-4-ynoic acid?
The InChIKey is TWHUGSIPDJQFDN-CQSZACIVSA-N. The full InChI is InChI=1S/C17H22O3/c1-5-6-14(11-16(18)19)13-7-9-15(10-8-13)20-12-17(2,3)4/h7-10,14H,11-12H2,1-4H3,(H,18,19)/t14-/m1/s1.
What are the key properties of (3R)-3-[4-(2,2-dimethylpropoxy)phenyl]hex-4-ynoic acid?
(3R)-3-[4-(2,2-dimethylpropoxy)phenyl]hex-4-ynoic acid has a molecular weight of 274.36 g/mol, XLogP of 3.69, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-[4-(2,2-dimethylpropoxy)phenyl]hex-4-ynoic acid is sourced from PubChem (CID 155409330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).