C27H32O4 — CID 56592202
3-[4-[[1-[(3-tert-butylphenoxy)methyl]cyclopropyl]methoxy]phenyl]hex-4-ynoic acid (PubChem CID 56592202) has the molecular formula C27H32O4 and a molecular weight of 420.55 g/mol. Its IUPAC name is 3-[4-[[1-[(3-tert-butylphenoxy)methyl]cyclopropyl]methoxy]phenyl]hex-4-ynoic acid.
| Compound Name | 3-[4-[[1-[(3-tert-butylphenoxy)methyl]cyclopropyl]methoxy]phenyl]hex-4-ynoic acid |
|---|---|
| PubChem CID | 56592202 |
| Molecular Formula | C27H32O4 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | 3-[4-[[1-[(3-tert-butylphenoxy)methyl]cyclopropyl]methoxy]phenyl]hex-4-ynoic acid |
| SMILES | CC#CC(CC(=O)O)c1ccc(OCC2(COc3cccc(C(C)(C)C)c3)CC2)cc1 |
| InChI | InChI=1S/C27H32O4/c1-5-7-21(16-25(28)29)20-10-12-23(13-11-20)30-18-27(14-15-27)19-31-24-9-6-8-22(17-24)26(2,3)4/h6,8-13,17,21H,14-16,18-19H2,1-4H3,(H,28,29) |
| InChIKey | LWFDITQKTZNGDE-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|