C23H23FO4 — CID 58031856
3-[4-[[1-[(2-fluorophenoxy)methyl]cyclopropyl]methoxy]phenyl]hex-4-ynoic acid (PubChem CID 58031856) has the molecular formula C23H23FO4 and a molecular weight of 382.43 g/mol. Its IUPAC name is 3-[4-[[1-[(2-fluorophenoxy)methyl]cyclopropyl]methoxy]phenyl]hex-4-ynoic acid.
| Compound Name | 3-[4-[[1-[(2-fluorophenoxy)methyl]cyclopropyl]methoxy]phenyl]hex-4-ynoic acid |
|---|---|
| PubChem CID | 58031856 |
| Molecular Formula | C23H23FO4 |
| Molecular Weight | 382.43 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 3-[4-[[1-[(2-fluorophenoxy)methyl]cyclopropyl]methoxy]phenyl]hex-4-ynoic acid |
| SMILES | CC#CC(CC(=O)O)c1ccc(OCC2(COc3ccccc3F)CC2)cc1 |
| InChI | InChI=1S/C23H23FO4/c1-2-5-18(14-22(25)26)17-8-10-19(11-9-17)27-15-23(12-13-23)16-28-21-7-4-3-6-20(21)24/h3-4,6-11,18H,12-16H2,1H3,(H,25,26) |
| InChIKey | IBFWQQFIIDZBQQ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.43 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|