C20H19FO4 — CID 58031763
3-[4-[2-(2-fluorophenoxy)ethoxy]phenyl]hex-4-ynoic acid (PubChem CID 58031763) has the molecular formula C20H19FO4 and a molecular weight of 342.37 g/mol. Its IUPAC name is 3-[4-[2-(2-fluorophenoxy)ethoxy]phenyl]hex-4-ynoic acid.
| Compound Name | 3-[4-[2-(2-fluorophenoxy)ethoxy]phenyl]hex-4-ynoic acid |
|---|---|
| PubChem CID | 58031763 |
| Molecular Formula | C20H19FO4 |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 3-[4-[2-(2-fluorophenoxy)ethoxy]phenyl]hex-4-ynoic acid |
| SMILES | CC#CC(CC(=O)O)c1ccc(OCCOc2ccccc2F)cc1 |
| InChI | InChI=1S/C20H19FO4/c1-2-5-16(14-20(22)23)15-8-10-17(11-9-15)24-12-13-25-19-7-4-3-6-18(19)21/h3-4,6-11,16H,12-14H2,1H3,(H,22,23) |
| InChIKey | XVSHLHOZWKTXKK-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|