C23H23F3O4 — CID 56592352
3-[4-[(3S)-3-[4-(trifluoromethyl)phenoxy]butoxy]phenyl]hex-4-ynoic acid (PubChem CID 56592352) has the molecular formula C23H23F3O4 and a molecular weight of 420.43 g/mol. Its IUPAC name is 3-[4-[(3S)-3-[4-(trifluoromethyl)phenoxy]butoxy]phenyl]hex-4-ynoic acid.
| Compound Name | 3-[4-[(3S)-3-[4-(trifluoromethyl)phenoxy]butoxy]phenyl]hex-4-ynoic acid |
|---|---|
| PubChem CID | 56592352 |
| Molecular Formula | C23H23F3O4 |
| Molecular Weight | 420.43 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | 3-[4-[(3S)-3-[4-(trifluoromethyl)phenoxy]butoxy]phenyl]hex-4-ynoic acid |
| SMILES | CC#CC(CC(=O)O)c1ccc(OCC[C@H](C)Oc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C23H23F3O4/c1-3-4-18(15-22(27)28)17-5-9-20(10-6-17)29-14-13-16(2)30-21-11-7-19(8-12-21)23(24,25)26/h5-12,16,18H,13-15H2,1-2H3,(H,27,28)/t16-,18?/m0/s1 |
| InChIKey | BWHHIMWKIQMGLX-ATNAJCNCSA-N |
| XLogP | 5.52 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.43 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|