C23H22ClF3O4 — CID 58031777
3-[4-[(3R)-3-[2-chloro-4-(trifluoromethyl)phenoxy]butoxy]phenyl]hex-4-ynoic acid (PubChem CID 58031777) has the molecular formula C23H22ClF3O4 and a molecular weight of 454.87 g/mol. Its IUPAC name is 3-[4-[(3R)-3-[2-chloro-4-(trifluoromethyl)phenoxy]butoxy]phenyl]hex-4-ynoic acid.
| Compound Name | 3-[4-[(3R)-3-[2-chloro-4-(trifluoromethyl)phenoxy]butoxy]phenyl]hex-4-ynoic acid |
|---|---|
| PubChem CID | 58031777 |
| Molecular Formula | C23H22ClF3O4 |
| Molecular Weight | 454.87 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | 3-[4-[(3R)-3-[2-chloro-4-(trifluoromethyl)phenoxy]butoxy]phenyl]hex-4-ynoic acid |
| SMILES | CC#CC(CC(=O)O)c1ccc(OCC[C@@H](C)Oc2ccc(C(F)(F)F)cc2Cl)cc1 |
| InChI | InChI=1S/C23H22ClF3O4/c1-3-4-17(13-22(28)29)16-5-8-19(9-6-16)30-12-11-15(2)31-21-10-7-18(14-20(21)24)23(25,26)27/h5-10,14-15,17H,11-13H2,1-2H3,(H,28,29)/t15-,17?/m1/s1 |
| InChIKey | IPCHEBKEWZHIBJ-LDCVWXEPSA-N |
| XLogP | 6.18 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.87 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|