C23H22ClFO4 — CID 56592456
3-[4-[[1-[(2-chloro-4-fluorophenoxy)methyl]cyclopropyl]methoxy]phenyl]hex-4-ynoic acid (PubChem CID 56592456) has the molecular formula C23H22ClFO4 and a molecular weight of 416.88 g/mol. Its IUPAC name is 3-[4-[[1-[(2-chloro-4-fluorophenoxy)methyl]cyclopropyl]methoxy]phenyl]hex-4-ynoic acid.
| Compound Name | 3-[4-[[1-[(2-chloro-4-fluorophenoxy)methyl]cyclopropyl]methoxy]phenyl]hex-4-ynoic acid |
|---|---|
| PubChem CID | 56592456 |
| Molecular Formula | C23H22ClFO4 |
| Molecular Weight | 416.88 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | 3-[4-[[1-[(2-chloro-4-fluorophenoxy)methyl]cyclopropyl]methoxy]phenyl]hex-4-ynoic acid |
| SMILES | CC#CC(CC(=O)O)c1ccc(OCC2(COc3ccc(F)cc3Cl)CC2)cc1 |
| InChI | InChI=1S/C23H22ClFO4/c1-2-3-17(12-22(26)27)16-4-7-19(8-5-16)28-14-23(10-11-23)15-29-21-9-6-18(25)13-20(21)24/h4-9,13,17H,10-12,14-15H2,1H3,(H,26,27) |
| InChIKey | SVOYUTNCFAALLV-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.88 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|