C25H24ClNO4 — CID 58031855
methyl 3-[4-[[1-[(3-chloro-4-cyanophenoxy)methyl]cyclopropyl]methoxy]phenyl]hex-4-ynoate (PubChem CID 58031855) has the molecular formula C25H24ClNO4 and a molecular weight of 437.92 g/mol. Its IUPAC name is methyl 3-[4-[[1-[(3-chloro-4-cyanophenoxy)methyl]cyclopropyl]methoxy]phenyl]hex-4-ynoate.
| Compound Name | methyl 3-[4-[[1-[(3-chloro-4-cyanophenoxy)methyl]cyclopropyl]methoxy]phenyl]hex-4-ynoate |
|---|---|
| PubChem CID | 58031855 |
| Molecular Formula | C25H24ClNO4 |
| Molecular Weight | 437.92 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | methyl 3-[4-[[1-[(3-chloro-4-cyanophenoxy)methyl]cyclopropyl]methoxy]phenyl]hex-4-ynoate |
| SMILES | CC#CC(CC(=O)OC)c1ccc(OCC2(COc3ccc(C#N)c(Cl)c3)CC2)cc1 |
| InChI | InChI=1S/C25H24ClNO4/c1-3-4-19(13-24(28)29-2)18-5-8-21(9-6-18)30-16-25(11-12-25)17-31-22-10-7-20(15-27)23(26)14-22/h5-10,14,19H,11-13,16-17H2,1-2H3 |
| InChIKey | FAPKGFLCUNKXQN-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.92 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|