C23H32O3 — CID 167220602
methyl (3R)-3-[4-[(E)-3,7-dimethyloct-2-enoxy]phenyl]hex-4-ynoate (PubChem CID 167220602) has the molecular formula C23H32O3 and a molecular weight of 356.51 g/mol. Its IUPAC name is methyl (3R)-3-[4-[(E)-3,7-dimethyloct-2-enoxy]phenyl]hex-4-ynoate.
| Compound Name | methyl (3R)-3-[4-[(E)-3,7-dimethyloct-2-enoxy]phenyl]hex-4-ynoate |
|---|---|
| PubChem CID | 167220602 |
| Molecular Formula | C23H32O3 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | methyl (3R)-3-[4-[(E)-3,7-dimethyloct-2-enoxy]phenyl]hex-4-ynoate |
| SMILES | CC#C[C@H](CC(=O)OC)c1ccc(OC/C=C(\C)CCCC(C)C)cc1 |
| InChI | InChI=1S/C23H32O3/c1-6-8-21(17-23(24)25-5)20-11-13-22(14-12-20)26-16-15-19(4)10-7-9-18(2)3/h11-15,18,21H,7,9-10,16-17H2,1-5H3/b19-15+/t21-/m1/s1 |
| InChIKey | NURDDUMNRNYJNY-JENJNIGESA-N |
| XLogP | 5.51 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|