C21H30O2 — CID 167220613
methyl 3-[4-(3-ethyl-4-methylpentyl)phenyl]hex-4-ynoate (PubChem CID 167220613) has the molecular formula C21H30O2 and a molecular weight of 314.47 g/mol. Its IUPAC name is methyl 3-[4-(3-ethyl-4-methylpentyl)phenyl]hex-4-ynoate.
| Compound Name | methyl 3-[4-(3-ethyl-4-methylpentyl)phenyl]hex-4-ynoate |
|---|---|
| PubChem CID | 167220613 |
| Molecular Formula | C21H30O2 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | methyl 3-[4-(3-ethyl-4-methylpentyl)phenyl]hex-4-ynoate |
| SMILES | CC#CC(CC(=O)OC)c1ccc(CCC(CC)C(C)C)cc1 |
| InChI | InChI=1S/C21H30O2/c1-6-8-20(15-21(22)23-5)19-13-10-17(11-14-19)9-12-18(7-2)16(3)4/h10-11,13-14,16,18,20H,7,9,12,15H2,1-5H3 |
| InChIKey | SZMBKQQGLLJWRB-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|