C23H26O4 — CID 140699239
ethyl (3S)-3-[4-[[4-[(1S)-1-hydroxyethyl]phenyl]methoxy]phenyl]hex-4-ynoate (PubChem CID 140699239) has the molecular formula C23H26O4 and a molecular weight of 366.46 g/mol. Its IUPAC name is ethyl (3S)-3-[4-[[4-[(1S)-1-hydroxyethyl]phenyl]methoxy]phenyl]hex-4-ynoate.
| Compound Name | ethyl (3S)-3-[4-[[4-[(1S)-1-hydroxyethyl]phenyl]methoxy]phenyl]hex-4-ynoate |
|---|---|
| PubChem CID | 140699239 |
| Molecular Formula | C23H26O4 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | ethyl (3S)-3-[4-[[4-[(1S)-1-hydroxyethyl]phenyl]methoxy]phenyl]hex-4-ynoate |
| SMILES | CC#C[C@@H](CC(=O)OCC)c1ccc(OCc2ccc([C@H](C)O)cc2)cc1 |
| InChI | InChI=1S/C23H26O4/c1-4-6-21(15-23(25)26-5-2)20-11-13-22(14-12-20)27-16-18-7-9-19(10-8-18)17(3)24/h7-14,17,21,24H,5,15-16H2,1-3H3/t17-,21-/m0/s1 |
| InChIKey | PQHVRTCVIOUMQJ-UWJYYQICSA-N |
| XLogP | 4.38 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|