C27H25N3O4 — CID 136992561
ethyl (3S)-3-[4-[[2-(4-hydroxyphenyl)-[1,2,4]triazolo[1,5-a]pyridin-6-yl]methoxy]phenyl]hex-4-ynoate (PubChem CID 136992561) has the molecular formula C27H25N3O4 and a molecular weight of 455.51 g/mol. Its IUPAC name is ethyl (3S)-3-[4-[[2-(4-hydroxyphenyl)-[1,2,4]triazolo[1,5-a]pyridin-6-yl]methoxy]phenyl]hex-4-ynoate.
| Compound Name | ethyl (3S)-3-[4-[[2-(4-hydroxyphenyl)-[1,2,4]triazolo[1,5-a]pyridin-6-yl]methoxy]phenyl]hex-4-ynoate |
|---|---|
| PubChem CID | 136992561 |
| Molecular Formula | C27H25N3O4 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | ethyl (3S)-3-[4-[[2-(4-hydroxyphenyl)-[1,2,4]triazolo[1,5-a]pyridin-6-yl]methoxy]phenyl]hex-4-ynoate |
| SMILES | CC#C[C@@H](CC(=O)OCC)c1ccc(OCc2ccc3nc(-c4ccc(O)cc4)nn3c2)cc1 |
| InChI | InChI=1S/C27H25N3O4/c1-3-5-22(16-26(32)33-4-2)20-9-13-24(14-10-20)34-18-19-6-15-25-28-27(29-30(25)17-19)21-7-11-23(31)12-8-21/h6-15,17,22,31H,4,16,18H2,1-2H3/t22-/m0/s1 |
| InChIKey | MFBACWNBHFWCFS-QFIPXVFZSA-N |
| XLogP | 4.74 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|