C16H15N3O3 — CID 154659111
ethyl 2-[6-(4-hydroxyphenyl)imidazo[1,2-b]pyridazin-2-yl]acetate (PubChem CID 154659111) has the molecular formula C16H15N3O3 and a molecular weight of 297.31 g/mol. Its IUPAC name is ethyl 2-[6-(4-hydroxyphenyl)imidazo[1,2-b]pyridazin-2-yl]acetate.
| Compound Name | ethyl 2-[6-(4-hydroxyphenyl)imidazo[1,2-b]pyridazin-2-yl]acetate |
|---|---|
| PubChem CID | 154659111 |
| Molecular Formula | C16H15N3O3 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | ethyl 2-[6-(4-hydroxyphenyl)imidazo[1,2-b]pyridazin-2-yl]acetate |
| SMILES | CCOC(=O)Cc1cn2nc(-c3ccc(O)cc3)ccc2n1 |
| InChI | InChI=1S/C16H15N3O3/c1-2-22-16(21)9-12-10-19-15(17-12)8-7-14(18-19)11-3-5-13(20)6-4-11/h3-8,10,20H,2,9H2,1H3 |
| InChIKey | AFCWLDGUTFTKGV-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |