C10H10N2O3 — CID 131340084
methyl 2-(6-hydroxyimidazo[1,2-a]pyridin-2-yl)acetate (PubChem CID 131340084) has the molecular formula C10H10N2O3 and a molecular weight of 206.20 g/mol. Its IUPAC name is methyl 2-(6-hydroxyimidazo[1,2-a]pyridin-2-yl)acetate.
| Compound Name | methyl 2-(6-hydroxyimidazo[1,2-a]pyridin-2-yl)acetate |
|---|---|
| PubChem CID | 131340084 |
| Molecular Formula | C10H10N2O3 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | methyl 2-(6-hydroxyimidazo[1,2-a]pyridin-2-yl)acetate |
| SMILES | COC(=O)Cc1cn2cc(O)ccc2n1 |
| InChI | InChI=1S/C10H10N2O3/c1-15-10(14)4-7-5-12-6-8(13)2-3-9(12)11-7/h2-3,5-6,13H,4H2,1H3 |
| InChIKey | NYCQVPXZZCXNBL-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |