2-[6-(dimethylamino)imidazo[1,2-a]pyridin-2-yl]acetic acid

C11H13N3O2 — CID 82022029

IUPAC2-[6-(dimethylamino)imidazo[1,2-a]pyridin-2-yl]acetic acid
SMILESCN(C)c1ccc2nc(CC(=O)O)cn2c1
InChIInChI=1S/C11H13N3O2/c1-13(2)9-3-4-10-12-8(5-11(15)16)6-14(10)7-9/h3-4,6-7H,5H2,1-2H3,(H,15,16)
InChIKeyVOYRLIWPSRIMPW-UHFFFAOYSA-N
MW219.24 g/mol
LogP1.03
Rot. Bonds3

About 2-[6-(dimethylamino)imidazo[1,2-a]pyridin-2-yl]acetic acid

2-[6-(dimethylamino)imidazo[1,2-a]pyridin-2-yl]acetic acid (PubChem CID 82022029) has the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. Its IUPAC name is 2-[6-(dimethylamino)imidazo[1,2-a]pyridin-2-yl]acetic acid.

Molecular Properties

Compound Name2-[6-(dimethylamino)imidazo[1,2-a]pyridin-2-yl]acetic acid
PubChem CID82022029
Molecular FormulaC11H13N3O2
Molecular Weight219.24 g/mol
Exact Mass219.10
IUPAC Name2-[6-(dimethylamino)imidazo[1,2-a]pyridin-2-yl]acetic acid
SMILESCN(C)c1ccc2nc(CC(=O)O)cn2c1
InChIInChI=1S/C11H13N3O2/c1-13(2)9-3-4-10-12-8(5-11(15)16)6-14(10)7-9/h3-4,6-7H,5H2,1-2H3,(H,15,16)
InChIKeyVOYRLIWPSRIMPW-UHFFFAOYSA-N
XLogP1.03
TPSA57.84 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500219.24
LogP ≤ 51.03
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-[6-(dimethylamino)imidazo[1,2-a]pyridin-2-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[6-(dimethylamino)imidazo[1,2-a]pyridin-2-yl]acetic acid?
The IUPAC name of 2-[6-(dimethylamino)imidazo[1,2-a]pyridin-2-yl]acetic acid (CID 82022029) is 2-[6-(dimethylamino)imidazo[1,2-a]pyridin-2-yl]acetic acid.
What is the SMILES notation for 2-[6-(dimethylamino)imidazo[1,2-a]pyridin-2-yl]acetic acid?
The canonical SMILES for 2-[6-(dimethylamino)imidazo[1,2-a]pyridin-2-yl]acetic acid is CN(C)c1ccc2nc(CC(=O)O)cn2c1.
What is the InChIKey of 2-[6-(dimethylamino)imidazo[1,2-a]pyridin-2-yl]acetic acid?
The InChIKey is VOYRLIWPSRIMPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3O2/c1-13(2)9-3-4-10-12-8(5-11(15)16)6-14(10)7-9/h3-4,6-7H,5H2,1-2H3,(H,15,16).
What are the key properties of 2-[6-(dimethylamino)imidazo[1,2-a]pyridin-2-yl]acetic acid?
2-[6-(dimethylamino)imidazo[1,2-a]pyridin-2-yl]acetic acid has a molecular weight of 219.24 g/mol, XLogP of 1.03, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6-(dimethylamino)imidazo[1,2-a]pyridin-2-yl]acetic acid is sourced from PubChem (CID 82022029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).