About 2-(6-hydroxyimidazo[1,2-a]pyridin-2-yl)acetonitrile
2-(6-hydroxyimidazo[1,2-a]pyridin-2-yl)acetonitrile (PubChem CID 131519071) has the molecular formula C9H7N3O
and a molecular weight of 173.17 g/mol. Its IUPAC name is 2-(6-hydroxyimidazo[1,2-a]pyridin-2-yl)acetonitrile.
Analyze 2-(6-hydroxyimidazo[1,2-a]pyridin-2-yl)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-hydroxyimidazo[1,2-a]pyridin-2-yl)acetonitrile?
The IUPAC name of 2-(6-hydroxyimidazo[1,2-a]pyridin-2-yl)acetonitrile (CID 131519071) is 2-(6-hydroxyimidazo[1,2-a]pyridin-2-yl)acetonitrile.
What is the SMILES notation for 2-(6-hydroxyimidazo[1,2-a]pyridin-2-yl)acetonitrile?
The canonical SMILES for 2-(6-hydroxyimidazo[1,2-a]pyridin-2-yl)acetonitrile is N#CCc1cn2cc(O)ccc2n1.
What is the InChIKey of 2-(6-hydroxyimidazo[1,2-a]pyridin-2-yl)acetonitrile?
The InChIKey is XBJWROJZFXZBDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N3O/c10-4-3-7-5-12-6-8(13)1-2-9(12)11-7/h1-2,5-6,13H,3H2.
What are the key properties of 2-(6-hydroxyimidazo[1,2-a]pyridin-2-yl)acetonitrile?
2-(6-hydroxyimidazo[1,2-a]pyridin-2-yl)acetonitrile has a molecular weight of 173.17 g/mol, XLogP of 1.11, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-hydroxyimidazo[1,2-a]pyridin-2-yl)acetonitrile is sourced from PubChem (CID 131519071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).