C12H10N2O2 — CID 117130980
2-(furan-2-ylmethyl)imidazo[1,2-a]pyridin-6-ol (PubChem CID 117130980) has the molecular formula C12H10N2O2 and a molecular weight of 214.22 g/mol. Its IUPAC name is 2-(furan-2-ylmethyl)imidazo[1,2-a]pyridin-6-ol.
| Compound Name | 2-(furan-2-ylmethyl)imidazo[1,2-a]pyridin-6-ol |
|---|---|
| PubChem CID | 117130980 |
| Molecular Formula | C12H10N2O2 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | 2-(furan-2-ylmethyl)imidazo[1,2-a]pyridin-6-ol |
| SMILES | Oc1ccc2nc(Cc3ccco3)cn2c1 |
| InChI | InChI=1S/C12H10N2O2/c15-10-3-4-12-13-9(7-14(12)8-10)6-11-2-1-5-16-11/h1-5,7-8,15H,6H2 |
| InChIKey | UVGJYMTUJLZKOU-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 50.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |