C13H16N2OS — CID 117129235
2-(thian-4-ylmethyl)imidazo[1,2-a]pyridin-6-ol (PubChem CID 117129235) has the molecular formula C13H16N2OS and a molecular weight of 248.35 g/mol. Its IUPAC name is 2-(thian-4-ylmethyl)imidazo[1,2-a]pyridin-6-ol.
| Compound Name | 2-(thian-4-ylmethyl)imidazo[1,2-a]pyridin-6-ol |
|---|---|
| PubChem CID | 117129235 |
| Molecular Formula | C13H16N2OS |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 2-(thian-4-ylmethyl)imidazo[1,2-a]pyridin-6-ol |
| SMILES | Oc1ccc2nc(CC3CCSCC3)cn2c1 |
| InChI | InChI=1S/C13H16N2OS/c16-12-1-2-13-14-11(8-15(13)9-12)7-10-3-5-17-6-4-10/h1-2,8-10,16H,3-7H2 |
| InChIKey | IMUOXSBDHJTXIC-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |