C17H24N4S — CID 117236324
7-piperazin-1-yl-2-(thian-4-ylmethyl)imidazo[1,2-a]pyridine (PubChem CID 117236324) has the molecular formula C17H24N4S and a molecular weight of 316.47 g/mol. Its IUPAC name is 7-piperazin-1-yl-2-(thian-4-ylmethyl)imidazo[1,2-a]pyridine.
| Compound Name | 7-piperazin-1-yl-2-(thian-4-ylmethyl)imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 117236324 |
| Molecular Formula | C17H24N4S |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 7-piperazin-1-yl-2-(thian-4-ylmethyl)imidazo[1,2-a]pyridine |
| SMILES | c1cn2cc(CC3CCSCC3)nc2cc1N1CCNCC1 |
| InChI | InChI=1S/C17H24N4S/c1-6-21-13-15(11-14-2-9-22-10-3-14)19-17(21)12-16(1)20-7-4-18-5-8-20/h1,6,12-14,18H,2-5,7-11H2 |
| InChIKey | YKRCAFWUDIRCPM-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 32.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |