C17H25N5 — CID 117236368
7-piperazin-1-yl-2-(piperidin-3-ylmethyl)imidazo[1,2-a]pyridine (PubChem CID 117236368) has the molecular formula C17H25N5 and a molecular weight of 299.42 g/mol. Its IUPAC name is 7-piperazin-1-yl-2-(piperidin-3-ylmethyl)imidazo[1,2-a]pyridine.
| Compound Name | 7-piperazin-1-yl-2-(piperidin-3-ylmethyl)imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 117236368 |
| Molecular Formula | C17H25N5 |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.21 |
| IUPAC Name | 7-piperazin-1-yl-2-(piperidin-3-ylmethyl)imidazo[1,2-a]pyridine |
| SMILES | c1cn2cc(CC3CCCNC3)nc2cc1N1CCNCC1 |
| InChI | InChI=1S/C17H25N5/c1-2-14(12-19-4-1)10-15-13-22-7-3-16(11-17(22)20-15)21-8-5-18-6-9-21/h3,7,11,13-14,18-19H,1-2,4-6,8-10,12H2 |
| InChIKey | CVVCOBMRULPVIX-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 44.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |