C16H22N4S — CID 117236308
7-piperazin-1-yl-2-(thian-4-yl)imidazo[1,2-a]pyridine (PubChem CID 117236308) has the molecular formula C16H22N4S and a molecular weight of 302.45 g/mol. Its IUPAC name is 7-piperazin-1-yl-2-(thian-4-yl)imidazo[1,2-a]pyridine.
| Compound Name | 7-piperazin-1-yl-2-(thian-4-yl)imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 117236308 |
| Molecular Formula | C16H22N4S |
| Molecular Weight | 302.45 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 7-piperazin-1-yl-2-(thian-4-yl)imidazo[1,2-a]pyridine |
| SMILES | c1cn2cc(C3CCSCC3)nc2cc1N1CCNCC1 |
| InChI | InChI=1S/C16H22N4S/c1-6-20-12-15(13-2-9-21-10-3-13)18-16(20)11-14(1)19-7-4-17-5-8-19/h1,6,11-13,17H,2-5,7-10H2 |
| InChIKey | DCVGAPUQKJMMEF-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 32.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.45 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |