C12H15N3S — CID 117133650
2-(thian-4-yl)imidazo[1,2-a]pyridin-7-amine (PubChem CID 117133650) has the molecular formula C12H15N3S and a molecular weight of 233.34 g/mol. Its IUPAC name is 2-(thian-4-yl)imidazo[1,2-a]pyridin-7-amine.
| Compound Name | 2-(thian-4-yl)imidazo[1,2-a]pyridin-7-amine |
|---|---|
| PubChem CID | 117133650 |
| Molecular Formula | C12H15N3S |
| Molecular Weight | 233.34 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 2-(thian-4-yl)imidazo[1,2-a]pyridin-7-amine |
| SMILES | Nc1ccn2cc(C3CCSCC3)nc2c1 |
| InChI | InChI=1S/C12H15N3S/c13-10-1-4-15-8-11(14-12(15)7-10)9-2-5-16-6-3-9/h1,4,7-9H,2-3,5-6,13H2 |
| InChIKey | SNJBUUKGMKEZCX-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.34 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |