C13H16N2S — CID 117135947
8-methyl-2-(thian-4-yl)imidazo[1,2-a]pyridine (PubChem CID 117135947) has the molecular formula C13H16N2S and a molecular weight of 232.35 g/mol. Its IUPAC name is 8-methyl-2-(thian-4-yl)imidazo[1,2-a]pyridine.
| Compound Name | 8-methyl-2-(thian-4-yl)imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 117135947 |
| Molecular Formula | C13H16N2S |
| Molecular Weight | 232.35 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 8-methyl-2-(thian-4-yl)imidazo[1,2-a]pyridine |
| SMILES | Cc1cccn2cc(C3CCSCC3)nc12 |
| InChI | InChI=1S/C13H16N2S/c1-10-3-2-6-15-9-12(14-13(10)15)11-4-7-16-8-5-11/h2-3,6,9,11H,4-5,7-8H2,1H3 |
| InChIKey | RPEHLXNSUUYHLC-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.35 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |