C13H14N2O2S — CID 117135873
methyl 2-(thiolan-3-yl)imidazo[1,2-a]pyridine-8-carboxylate (PubChem CID 117135873) has the molecular formula C13H14N2O2S and a molecular weight of 262.33 g/mol. Its IUPAC name is methyl 2-(thiolan-3-yl)imidazo[1,2-a]pyridine-8-carboxylate.
| Compound Name | methyl 2-(thiolan-3-yl)imidazo[1,2-a]pyridine-8-carboxylate |
|---|---|
| PubChem CID | 117135873 |
| Molecular Formula | C13H14N2O2S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | methyl 2-(thiolan-3-yl)imidazo[1,2-a]pyridine-8-carboxylate |
| SMILES | COC(=O)c1cccn2cc(C3CCSC3)nc12 |
| InChI | InChI=1S/C13H14N2O2S/c1-17-13(16)10-3-2-5-15-7-11(14-12(10)15)9-4-6-18-8-9/h2-3,5,7,9H,4,6,8H2,1H3 |
| InChIKey | UAAAQVZVDDEWNK-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |