C12H14N2 — CID 117137735
2-cyclobutyl-8-methylimidazo[1,2-a]pyridine (PubChem CID 117137735) has the molecular formula C12H14N2 and a molecular weight of 186.26 g/mol. Its IUPAC name is 2-cyclobutyl-8-methylimidazo[1,2-a]pyridine.
| Compound Name | 2-cyclobutyl-8-methylimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 117137735 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 2-cyclobutyl-8-methylimidazo[1,2-a]pyridine |
| SMILES | Cc1cccn2cc(C3CCC3)nc12 |
| InChI | InChI=1S/C12H14N2/c1-9-4-3-7-14-8-11(13-12(9)14)10-5-2-6-10/h3-4,7-8,10H,2,5-6H2,1H3 |
| InChIKey | XZFNROXYDBUIHA-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |