C12H15N3 — CID 117137734
(2-cyclobutylimidazo[1,2-a]pyridin-8-yl)methanamine (PubChem CID 117137734) has the molecular formula C12H15N3 and a molecular weight of 201.27 g/mol. Its IUPAC name is (2-cyclobutylimidazo[1,2-a]pyridin-8-yl)methanamine.
| Compound Name | (2-cyclobutylimidazo[1,2-a]pyridin-8-yl)methanamine |
|---|---|
| PubChem CID | 117137734 |
| Molecular Formula | C12H15N3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | (2-cyclobutylimidazo[1,2-a]pyridin-8-yl)methanamine |
| SMILES | NCc1cccn2cc(C3CCC3)nc12 |
| InChI | InChI=1S/C12H15N3/c13-7-10-5-2-6-15-8-11(14-12(10)15)9-3-1-4-9/h2,5-6,8-9H,1,3-4,7,13H2 |
| InChIKey | FXQSVEVYPDWUIW-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |