C12H14N2O — CID 117137747
2-cyclopentylimidazo[1,2-a]pyridin-8-ol (PubChem CID 117137747) has the molecular formula C12H14N2O and a molecular weight of 202.26 g/mol. Its IUPAC name is 2-cyclopentylimidazo[1,2-a]pyridin-8-ol.
| Compound Name | 2-cyclopentylimidazo[1,2-a]pyridin-8-ol |
|---|---|
| PubChem CID | 117137747 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 2-cyclopentylimidazo[1,2-a]pyridin-8-ol |
| SMILES | Oc1cccn2cc(C3CCCC3)nc12 |
| InChI | InChI=1S/C12H14N2O/c15-11-6-3-7-14-8-10(13-12(11)14)9-4-1-2-5-9/h3,6-9,15H,1-2,4-5H2 |
| InChIKey | TZHWTUHZEJKVPT-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |