C13H17N3O — CID 117136486
2-(1-ethylpyrrolidin-2-yl)imidazo[1,2-a]pyridin-8-ol (PubChem CID 117136486) has the molecular formula C13H17N3O and a molecular weight of 231.30 g/mol. Its IUPAC name is 2-(1-ethylpyrrolidin-2-yl)imidazo[1,2-a]pyridin-8-ol.
| Compound Name | 2-(1-ethylpyrrolidin-2-yl)imidazo[1,2-a]pyridin-8-ol |
|---|---|
| PubChem CID | 117136486 |
| Molecular Formula | C13H17N3O |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | 2-(1-ethylpyrrolidin-2-yl)imidazo[1,2-a]pyridin-8-ol |
| SMILES | CCN1CCCC1c1cn2cccc(O)c2n1 |
| InChI | InChI=1S/C13H17N3O/c1-2-15-7-3-5-11(15)10-9-16-8-4-6-12(17)13(16)14-10/h4,6,8-9,11,17H,2-3,5,7H2,1H3 |
| InChIKey | XLICQPYVAKCTQQ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 40.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |