C15H21N3 — CID 117136613
2-(1-ethylpiperidin-2-yl)-8-methylimidazo[1,2-a]pyridine (PubChem CID 117136613) has the molecular formula C15H21N3 and a molecular weight of 243.35 g/mol. Its IUPAC name is 2-(1-ethylpiperidin-2-yl)-8-methylimidazo[1,2-a]pyridine.
| Compound Name | 2-(1-ethylpiperidin-2-yl)-8-methylimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 117136613 |
| Molecular Formula | C15H21N3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | 2-(1-ethylpiperidin-2-yl)-8-methylimidazo[1,2-a]pyridine |
| SMILES | CCN1CCCCC1c1cn2cccc(C)c2n1 |
| InChI | InChI=1S/C15H21N3/c1-3-17-9-5-4-8-14(17)13-11-18-10-6-7-12(2)15(18)16-13/h6-7,10-11,14H,3-5,8-9H2,1-2H3 |
| InChIKey | QZARGCWQEALXQS-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 20.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |