C13H16N2O2S — CID 117135939
4-(8-methylimidazo[1,2-a]pyridin-2-yl)thiane 1,1-dioxide (PubChem CID 117135939) has the molecular formula C13H16N2O2S and a molecular weight of 264.35 g/mol. Its IUPAC name is 4-(8-methylimidazo[1,2-a]pyridin-2-yl)thiane 1,1-dioxide.
| Compound Name | 4-(8-methylimidazo[1,2-a]pyridin-2-yl)thiane 1,1-dioxide |
|---|---|
| PubChem CID | 117135939 |
| Molecular Formula | C13H16N2O2S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 4-(8-methylimidazo[1,2-a]pyridin-2-yl)thiane 1,1-dioxide |
| SMILES | Cc1cccn2cc(C3CCS(=O)(=O)CC3)nc12 |
| InChI | InChI=1S/C13H16N2O2S/c1-10-3-2-6-15-9-12(14-13(10)15)11-4-7-18(16,17)8-5-11/h2-3,6,9,11H,4-5,7-8H2,1H3 |
| InChIKey | JMMTZUHPXGJYLL-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 51.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |