C14H18N2S — CID 117136976
8-methyl-2-(thian-3-ylmethyl)imidazo[1,2-a]pyridine (PubChem CID 117136976) has the molecular formula C14H18N2S and a molecular weight of 246.38 g/mol. Its IUPAC name is 8-methyl-2-(thian-3-ylmethyl)imidazo[1,2-a]pyridine.
| Compound Name | 8-methyl-2-(thian-3-ylmethyl)imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 117136976 |
| Molecular Formula | C14H18N2S |
| Molecular Weight | 246.38 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 8-methyl-2-(thian-3-ylmethyl)imidazo[1,2-a]pyridine |
| SMILES | Cc1cccn2cc(CC3CCCSC3)nc12 |
| InChI | InChI=1S/C14H18N2S/c1-11-4-2-6-16-9-13(15-14(11)16)8-12-5-3-7-17-10-12/h2,4,6,9,12H,3,5,7-8,10H2,1H3 |
| InChIKey | XEHCJANFNLVOJU-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.38 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |