C13H18N4 — CID 117133609
(2-piperidin-4-ylimidazo[1,2-a]pyridin-7-yl)methanamine (PubChem CID 117133609) has the molecular formula C13H18N4 and a molecular weight of 230.31 g/mol. Its IUPAC name is (2-piperidin-4-ylimidazo[1,2-a]pyridin-7-yl)methanamine.
| Compound Name | (2-piperidin-4-ylimidazo[1,2-a]pyridin-7-yl)methanamine |
|---|---|
| PubChem CID | 117133609 |
| Molecular Formula | C13H18N4 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | (2-piperidin-4-ylimidazo[1,2-a]pyridin-7-yl)methanamine |
| SMILES | NCc1ccn2cc(C3CCNCC3)nc2c1 |
| InChI | InChI=1S/C13H18N4/c14-8-10-3-6-17-9-12(16-13(17)7-10)11-1-4-15-5-2-11/h3,6-7,9,11,15H,1-2,4-5,8,14H2 |
| InChIKey | NWMKGNMEZPQFSF-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 55.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |