C12H14ClN3S — CID 117251665
1-chloro-3-(thian-4-yl)imidazo[1,5-a]pyridin-7-amine (PubChem CID 117251665) has the molecular formula C12H14ClN3S and a molecular weight of 267.78 g/mol. Its IUPAC name is 1-chloro-3-(thian-4-yl)imidazo[1,5-a]pyridin-7-amine.
| Compound Name | 1-chloro-3-(thian-4-yl)imidazo[1,5-a]pyridin-7-amine |
|---|---|
| PubChem CID | 117251665 |
| Molecular Formula | C12H14ClN3S |
| Molecular Weight | 267.78 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 1-chloro-3-(thian-4-yl)imidazo[1,5-a]pyridin-7-amine |
| SMILES | Nc1ccn2c(C3CCSCC3)nc(Cl)c2c1 |
| InChI | InChI=1S/C12H14ClN3S/c13-11-10-7-9(14)1-4-16(10)12(15-11)8-2-5-17-6-3-8/h1,4,7-8H,2-3,5-6,14H2 |
| InChIKey | OTWFJMRPKQEPBV-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.78 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |