C12H15ClN4 — CID 117254085
1-chloro-3-piperidin-3-ylimidazo[1,5-a]pyridin-7-amine (PubChem CID 117254085) has the molecular formula C12H15ClN4 and a molecular weight of 250.73 g/mol. Its IUPAC name is 1-chloro-3-piperidin-3-ylimidazo[1,5-a]pyridin-7-amine.
| Compound Name | 1-chloro-3-piperidin-3-ylimidazo[1,5-a]pyridin-7-amine |
|---|---|
| PubChem CID | 117254085 |
| Molecular Formula | C12H15ClN4 |
| Molecular Weight | 250.73 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 1-chloro-3-piperidin-3-ylimidazo[1,5-a]pyridin-7-amine |
| SMILES | Nc1ccn2c(C3CCCNC3)nc(Cl)c2c1 |
| InChI | InChI=1S/C12H15ClN4/c13-11-10-6-9(14)3-5-17(10)12(16-11)8-2-1-4-15-7-8/h3,5-6,8,15H,1-2,4,7,14H2 |
| InChIKey | NBHJHKNAWOBZFY-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 55.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.73 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |