C15H21N5S — CID 117236349
7-piperazin-1-yl-2-(thian-2-yl)-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 117236349) has the molecular formula C15H21N5S and a molecular weight of 303.43 g/mol. Its IUPAC name is 7-piperazin-1-yl-2-(thian-2-yl)-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 7-piperazin-1-yl-2-(thian-2-yl)-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 117236349 |
| Molecular Formula | C15H21N5S |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 7-piperazin-1-yl-2-(thian-2-yl)-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | c1cn2nc(C3CCCCS3)nc2cc1N1CCNCC1 |
| InChI | InChI=1S/C15H21N5S/c1-2-10-21-13(3-1)15-17-14-11-12(4-7-20(14)18-15)19-8-5-16-6-9-19/h4,7,11,13,16H,1-3,5-6,8-10H2 |
| InChIKey | GWCMOWUGBYUKIK-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 45.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |