C14H21N5 — CID 117236422
2-tert-butyl-7-piperazin-1-yl-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 117236422) has the molecular formula C14H21N5 and a molecular weight of 259.36 g/mol. Its IUPAC name is 2-tert-butyl-7-piperazin-1-yl-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 2-tert-butyl-7-piperazin-1-yl-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 117236422 |
| Molecular Formula | C14H21N5 |
| Molecular Weight | 259.36 g/mol |
| Exact Mass | 259.18 |
| IUPAC Name | 2-tert-butyl-7-piperazin-1-yl-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | CC(C)(C)c1nc2cc(N3CCNCC3)ccn2n1 |
| InChI | InChI=1S/C14H21N5/c1-14(2,3)13-16-12-10-11(4-7-19(12)17-13)18-8-5-15-6-9-18/h4,7,10,15H,5-6,8-9H2,1-3H3 |
| InChIKey | CTNVOHJGOXQCHC-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 45.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.36 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |