C12H19ClN2 — CID 56766536
1-(3,4-dimethylphenyl)piperazine;hydrochloride (PubChem CID 56766536) has the molecular formula C12H19ClN2 and a molecular weight of 226.75 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)piperazine;hydrochloride.
| Compound Name | 1-(3,4-dimethylphenyl)piperazine;hydrochloride |
|---|---|
| PubChem CID | 56766536 |
| Molecular Formula | C12H19ClN2 |
| Molecular Weight | 226.75 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 1-(3,4-dimethylphenyl)piperazine;hydrochloride |
| SMILES | Cc1ccc(N2CCNCC2)cc1C.Cl |
| InChI | InChI=1S/C12H18N2.ClH/c1-10-3-4-12(9-11(10)2)14-7-5-13-6-8-14;/h3-4,9,13H,5-8H2,1-2H3;1H |
| InChIKey | PEIHRINRWMGBIY-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.75 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|