C14H20N2O — CID 117015442
1-(3,4-dimethylphenyl)-1,4-diazocan-5-one (PubChem CID 117015442) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-1,4-diazocan-5-one.
| Compound Name | 1-(3,4-dimethylphenyl)-1,4-diazocan-5-one |
|---|---|
| PubChem CID | 117015442 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-1,4-diazocan-5-one |
| SMILES | Cc1ccc(N2CCCC(=O)NCC2)cc1C |
| InChI | InChI=1S/C14H20N2O/c1-11-5-6-13(10-12(11)2)16-8-3-4-14(17)15-7-9-16/h5-6,10H,3-4,7-9H2,1-2H3,(H,15,17) |
| InChIKey | BOBJNUFNYDNOIH-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|