C12H15ClN2O — CID 117015458
1-(2-chlorophenyl)-1,4-diazocan-5-one (PubChem CID 117015458) has the molecular formula C12H15ClN2O and a molecular weight of 238.72 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-1,4-diazocan-5-one.
| Compound Name | 1-(2-chlorophenyl)-1,4-diazocan-5-one |
|---|---|
| PubChem CID | 117015458 |
| Molecular Formula | C12H15ClN2O |
| Molecular Weight | 238.72 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 1-(2-chlorophenyl)-1,4-diazocan-5-one |
| SMILES | O=C1CCCN(c2ccccc2Cl)CCN1 |
| InChI | InChI=1S/C12H15ClN2O/c13-10-4-1-2-5-11(10)15-8-3-6-12(16)14-7-9-15/h1-2,4-5H,3,6-9H2,(H,14,16) |
| InChIKey | DTLLPFKOEUIYSZ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.72 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |